|
CAS#: 4298-20-8 Product: 5-Hydroxytryptophan No suppilers available for the product. |
| Name | 5-Hydroxytryptophan |
|---|---|
| Synonyms | 2-Amino-3-(5-Hydroxy-1H-Indol-3-Yl)Propionic Acid; 5-22-14-00278 (Beilstein Handbook Reference); 5-Hydroxytryptophan L-Form |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 |
| CAS Registry Number | 4298-20-8 (114-03-4) |
| SMILES | C1=C(O)C=CC2=C1C(=C[NH]2)CC(C(O)=O)N |
| InChI | 1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| InChIKey | LDCYZAJDBXYCGN-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 298°C (Expl.) |
| Boiling point | 520.6±50.0°C at 760 mmHg (Cal.) |
| Flash point | 268.7±30.1°C (Cal.) |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
|---|---|
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| Market Analysis Reports |