| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-(4-Chlorophenyl)-2-Phenyldiazene |
|---|---|
| Synonyms | (4-Chlorophenyl)-Phenyl-Diazene; 4-Chloroazobenzene; Azobenzene, 4-Chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.67 |
| CAS Registry Number | 4340-77-6 (6141-95-3) |
| SMILES | C2=C(N=NC1=CC=CC=C1)C=CC(=C2)Cl |
| InChI | 1S/C12H9ClN2/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | NJFDMENHTAYHMA-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.244°C at 760 mmHg (Cal.) |
| Flash point | 156.55°C (Cal.) |
| (1) | Rasmus J. Enemærke, Torben B. Christensen, Henrik Jensen and Kim Daasbjerg. Application of a new kinetic method in the investigation of cleavage reactions of haloaromatic radical anions, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 1620. |
|---|---|
| Market Analysis Reports |