| Fenhe Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.fenhechem.com | |||
![]() | +86 (021) 3392-6068 | |||
![]() | julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Name | 1,1',1'',1'''-Ethene-1,1,2,2-tetrayltetrakis(4-fluorobenzene) |
|---|---|
| Synonyms | 1-fluoro-4-[1,2,2-tris(4-fluorophenyl)ethenyl]benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C26H16F4 |
| Molecular Weight | 404.40 |
| CAS Registry Number | 435-08-5 |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)F |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.596, Calc.* |
| Boiling Point | 419.4±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 189.4±17.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
|
1,1',1'',1'''-Ethene-1,1,2,2-tetrayltetrakis(4-fluorobenzene), commonly referred to as tetra(4-fluorophenyl)ethylene, is a chemical compound characterized by a central ethylene core with four fluorobenzene rings attached to it. The molecular formula for this compound is C28H16F4. Its discovery and development are part of ongoing research into fluorinated organic molecules, which are of particular interest due to their unique electronic and structural properties. The discovery of tetra(4-fluorophenyl)ethylene is rooted in the broader field of organofluorine chemistry, which began to expand significantly in the mid-20th century. Fluorine atoms, when incorporated into organic molecules, can dramatically alter the chemical and physical properties of the resulting compounds, making them valuable in various applications ranging from pharmaceuticals to materials science. Tetra(4-fluorophenyl)ethylene was developed as part of efforts to explore how multiple fluorinated aromatic rings could influence the behavior of ethylene derivatives. The synthesis of 1,1',1'',1'''-Ethene-1,1,2,2-tetrayltetrakis(4-fluorobenzene) typically involves the use of fluorinated benzene derivatives, which are coupled to an ethylene backbone through various organic reactions. The synthesis is designed to maintain the integrity of the fluorine atoms on the benzene rings, as these atoms are crucial for the compound's desired properties. One of the key applications of tetra(4-fluorophenyl)ethylene is in the field of materials science, particularly in the development of advanced polymers and organic semiconductors. The presence of fluorine atoms in the compound contributes to increased chemical stability, resistance to degradation, and altered electronic properties, which are desirable in the creation of high-performance materials. These properties make it an attractive candidate for use in organic light-emitting diodes (OLEDs), organic photovoltaic cells (OPVs), and other electronic devices. In OLEDs, for example, tetra(4-fluorophenyl)ethylene can be used as a component in the emissive layer, where its unique photophysical properties can contribute to improved device efficiency and longevity. Similarly, in OPVs, the compound's ability to participate in charge transport processes can enhance the overall performance of the solar cells, potentially leading to more efficient conversion of sunlight into electricity. Beyond electronics, tetra(4-fluorophenyl)ethylene has also been explored for its potential use in creating novel polymeric materials. The rigidity and planarity of the molecule allow it to form well-ordered crystalline structures, which can be beneficial in producing polymers with specific mechanical and optical properties. These materials could have applications in areas such as coatings, packaging, and even biomedical devices, where durability and performance are critical. The study of tetra(4-fluorophenyl)ethylene also provides valuable insights into the broader field of fluorine chemistry. By understanding how the incorporation of multiple fluorinated aromatic rings affects the properties of ethylene-based compounds, researchers can better design new materials with tailored functionalities. This knowledge is essential for advancing the development of next-generation materials that meet the needs of various high-tech industries. In summary, 1,1',1'',1'''-Ethene-1,1,2,2-tetrayltetrakis(4-fluorobenzene) is a significant compound in the field of materials science and organic electronics. Its discovery and application highlight the importance of fluorinated compounds in the development of advanced technologies. As research continues, this compound is likely to play a crucial role in the creation of new materials with enhanced performance characteristics. |
| Market Analysis Reports |