| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Isopropenyl-3-Methoxy-1H-Pyrrole |
|---|---|
| Synonyms | 1-(1-Methylethenyl)-3-methoxypyrrole; 3-methoxy-1-(prop-1-en-2-yl)-1H-pyrrole; InChI=1/C8H11NO/c1-7(2)9-5-4-8(6-9)10-3/h4-6H,1H2,2-3H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 |
| CAS Registry Number | 439856-60-7 |
| SMILES | CC(=C)N1C=CC(=C1)OC |
| InChI | 1S/C8H11NO/c1-7(2)9-5-4-8(6-9)10-3/h4-6H,1H2,2-3H3 |
| InChIKey | UOMQINIIWXFUGD-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 181.6±22.0°C at 760 mmHg (Cal.) |
| Flash point | 63.7±22.3°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| (1) | Abd El-Aal M. Gaber, Gordon A. Hunter and Hamish McNab. 3-Hydroxypyrroles and 1H-pyrrol-3(2H)-ones. Part 14. Pyrolysis of oxazolidinylmethylene derivatives of Meldrum's acid – synthesis of N-alkenyl-3-hydroxypyrroles and related reactions, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 548. |
|---|---|
| Market Analysis Reports |