| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | (4-Bromo-Phenyl)-Phenyl-Diazene |
|---|---|
| Synonyms | (4-Bromophenyl)-Phenyl-Diazene; 4-Bromoazobenzene; Azobenzene, 4-Bromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 |
| CAS Registry Number | 4418-84-2 |
| SMILES | C1=CC(=CC=C1N=NC2=CC=CC=C2)Br |
| InChI | 1S/C12H9BrN2/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | SVJSEJOASMWXGQ-UHFFFAOYSA-N |
| (1) | Manuel Kaiser, Sebastian P. Leitner, Christa Hirtenlehner, Manuela List, Alexander Gerisch and Uwe Monkowius. Azobenzene-functionalized N-heterocyclic carbenes as photochromic ligands in silver(i) and gold(i) complexes, Dalton Trans., 2013, . |
|---|---|
| Market Analysis Reports |