| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Tikslioji Sinteze | Lithuania | |||
|---|---|---|---|---|
![]() |
+370 (5) 213-5553 | |||
![]() |
ardan@micro.lt | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | N,N-Di-n-Hexylaniline |
| Synonyms | Dihexyl-Phenyl-Amine; 545171_Aldrich; N,N-Di-N-Hexylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 |
| CAS Registry Number | 4430-09-5 |
| SMILES | C1=C(N(CCCCCC)CCCCCC)C=CC=C1 |
| InChI | 1S/C18H31N/c1-3-5-7-12-16-19(17-13-8-6-4-2)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | DGYRVXQIGUEFFK-UHFFFAOYSA-N |
| Density | 0.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.833°C at 760 mmHg (Cal.) |
| Flash point | 144.218°C (Cal.) |
| Market Analysis Reports |