| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,2-Bis(Diphenylarsino)Ethane |
|---|---|
| Synonyms | 3-16-00-00924 (Beilstein Handbook Reference); Arsine, Ethylenebis(Diphenyl-; Brn 2950878 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H24As2 |
| Molecular Weight | 486.32 |
| CAS Registry Number | 4431-24-7 |
| EINECS | 224-629-7 |
| SMILES | C4=C([As](C1=CC=CC=C1)CC[As](C2=CC=CC=C2)C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C26H24As2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2 |
| InChIKey | PZEXNMSXAVGEAP-UHFFFAOYSA-N |
| Boiling point | 521.435°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 270.655°C (Cal.) |
| (1) | Gregory J. Grant, Desirée A. Benefield and Donald G. VanDerveer. Thiacrown Pt complexes with group 15 donor ligands: pentacoordination in Pt(ii) complexes, Dalton Trans., 2009, 8605. |
|---|---|
| Market Analysis Reports |