| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Furyl(Phenyl)Methanol |
|---|---|
| Synonyms | 2-Furyl-Phenyl-Methanol; 2-Furyl-Phenylmethanol; Furan-2-Yl-Phenyl-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 4484-57-5 |
| SMILES | C1=C(OC=C1)C(O)C2=CC=CC=C2 |
| InChI | 1S/C11H10O2/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8,11-12H |
| InChIKey | FWIQIDYJWKRMFG-UHFFFAOYSA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.315°C at 760 mmHg (Cal.) |
| Flash point | 114.259°C (Cal.) |
| (1) | Maurizio D'Auria, Lucia Emanuele and Rocco Racioppi. On the Paternò–Büchi reaction of chiral phenylglyoxylate esters with furan derivatives, Photochem. Photobiol. Sci., 2003, 2, 904. |
|---|---|
| Market Analysis Reports |