| Chengdu Jinglin Biotechnology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.jinglinbio.com | |||
![]() | +86 17380623303 | |||
![]() | yunxicaroline@gmail.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2021 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glutamic acid derivative |
|---|---|
| Name | Lysylglutamic acid |
| Synonyms | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]pentanedioic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30 |
| Protein Sequence | KE |
| CAS Registry Number | 45234-02-4 |
| SMILES | C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N |
| Solubility | 5.159e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.538, Calc.* |
| Melting point | 314.10 °C |
| Boiling Point | 548.97 °C, 596.4±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 314.5±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |