| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Pentafluorophenyl Ethenesulfonate |
|---|---|
| Synonyms | 2,3,4,5,6-Pentafluorophenyl 1-ethylenesulfonate; MFCD06659554; perfluorophenyl ethenesulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3F5O3S |
| Molecular Weight | 274.16 |
| CAS Registry Number | 452905-58-7 |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)\C=C |
| InChI | 1S/C8H3F5O3S/c1-2-17(14,15)16-8-6(12)4(10)3(9)5(11)7(8)13/h2H,1H2 |
| InChIKey | NVXWLLDJCHOIBZ-UHFFFAOYSA-N |
| Density | 1.641g/cm3 (Cal.) |
|---|---|
| Boiling point | 74°C (Expl.) |
| 190.8°C at 760 mmHg (Cal.) | |
| Flash point | 69.194°C (Cal.) |
| Refractive index | 1.473 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Chieh Chien Lee, Richard J. Fitzmaurice and Stephen Caddick. 3,5-Isoxazoles from α-bromo-pentafluorophenyl vinylsulfonates: Synthesis of sulfonates and sulfonamides, Org. Biomol. Chem., 2009, 7, 4349. |
|---|---|
| Market Analysis Reports |