Online Database of Chemicals from Around the World
(2β,3β,5β)-2,3,14,20,22,25-Hexahydroxycholestan-6-one
[CAS 457603-63-3]
Identification| Name | (2β,3β,5β)-2,3,14,20,22,25-Hexahydroxycholestan-6-one |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.65 |
| CAS Registry Number | 457603-63-3 |
| SMILES | CC(C)(O)CCC(O)[C@](C)(O)[C@H]1CC[C@@]2(O)[C@@H]3CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@@]21C |
|
Properties
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.585, Calc.* |
| Boiling Point | 680.1±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 379.1±28.0 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
Hexahydro-1,3,5... 1-[(4aR,10bR)-2... Hexahydro-1,3,5... Hexahydro-1,3,5... Hexahydro-1,3,5... Hexahydro-1,3,5... 1,2,4,5,6,8-Hex... Hexahydroxybenz... (2S)-7-[[4,6-O-... (20R,22R,24S)-2... 1,1,6,6,7,7-Hex... 1,2',5',6,9,10'... (1S,1'S,10R,10'... (2S)-1,1',6,6',... 5,5'-[[1,1',6,6... 1,3,4,6,8,13-He... (3beta,4alpha,9... (22R)-2beta,3be... 3,3',4',5,6,7-H... 3,3',4',5,5',7-...