| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Trimethoxy-Phenyl-Silane |
|---|---|
| Synonyms | Trimethoxy-Phenyl-Silane; Nsc 93925 |
| Molecular Formula | C9H14O3Si |
| Molecular Weight | 198.29 |
| CAS Registry Number | 46143-12-8 |
| EINECS | 221-066-9 |
| SMILES | C1=C([Si](OC)(OC)OC)C=CC=C1 |
| InChI | 1S/C9H14O3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 20 (Expl.) | |
| Melting point | -25°C (Expl.) |
| Boiling point | 233°C (Expl.) |
| 185.7±9.0°C at 760 mmHg (Cal.) | |
| Flash point | 63.8±26.2°C (Cal.) |
| 84°C (Expl.) | |
| Refractive index | 1.4735 (Expl.) |
| Safety Code | S23;S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| DANGER: POISON, causes CNS injury | |
| (1) | Regina Okner, Gregory Favaro, Anna Radko, Abraham Jacob Domb and Daniel Mandler. Electrochemical codeposition of sol–gel films on stainless steel: controlling the chemical and physical coating properties of biomedical implants, Phys. Chem. Chem. Phys., 2010, 12, 15265. |
|---|---|
| Market Analysis Reports |