| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Terbutaline |
|---|---|
| Synonyms | 5-[2-(Tert-Butylamino)-1-Hydroxy-Ethyl]Benzene-1,3-Diol; 5-[2-(Tert-Butylamino)-1-Hydroxy-Ethyl]Resorcinol; Ninds_000078 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 46719-29-3 |
| SMILES | C1=C(C=C(C=C1C(CNC(C)(C)C)O)O)O |
| InChI | 1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChIKey | XWTYSIMOBUGWOL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 165.3±17.9°C (Cal.) |
| (1) | Haiwei Gu, Bin Hu, Jianqiang Li, Shuiping Yang, Jing Han and Huanwen Chen. Rapid analysis of aerosol drugs using nano extractive electrospray ionization tandem mass spectrometry, Analyst, 2010, 135, 1259. |
|---|---|
| Market Analysis Reports |