| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | N,N-Dimethylamino-2,4-Pentadiene-5-Al |
|---|---|
| Synonyms | (2E,4E)-5-Dimethylaminopenta-2,4-Dienal; 2,4-Pentadienal, 5-(Dimethylamino)-, (2E,4E)-; Inchi=1/C7h11no/C1-8(2)6-4-3-5-7-9/H3-7H,1-2H3/B5-3+,6-4 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 |
| CAS Registry Number | 4688-60-2 |
| SMILES | CN(\C=C\C=C\C=O)C |
| InChI | 1S/C7H11NO/c1-8(2)6-4-3-5-7-9/h3-7H,1-2H3/b5-3+,6-4+ |
| InChIKey | MJPXUXNGHKYZIV-GGWOSOGESA-N |
| (1) | Evans P. Andrew, Huang Mu-Hua, Lawler Michael J., Maroto Sergio. Total synthesis of marinomycin A using salicylate as a molecular switch to mediate dimerization, Nature Chemistry, 2012 |
|---|---|
| Market Analysis Reports |