| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| Name | 1,2,3,4-Tetrahydro-1,1,6-Trimethyl-Naphthalene |
|---|---|
| Synonyms | 1,1,6-Trimethyltetralin; 1,1,6-Trimethyltetraline; 1,2,3,4-Tetrahydro-1,1,6-Trimethylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 |
| CAS Registry Number | 475-03-6 |
| EINECS | 207-490-7 |
| SMILES | C1=CC(=CC2=C1C(C)(C)CCC2)C |
| InChI | 1S/C13H18/c1-10-6-7-12-11(9-10)5-4-8-13(12,2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | LTMQZVLXCLQPCT-UHFFFAOYSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.268°C at 760 mmHg (Cal.) |
| Flash point | 97.799°C (Cal.) |
| (1) | Miha Lukšič, Barbara Hribar-Lee, Richard Buchner and Vojko Vlachy. Modelling fast mode dielectric relaxation of counterions in aqueous solutions of ionene bromides and fluorides, Phys. Chem. Chem. Phys., 2009, 11, 10053. |
|---|---|
| Market Analysis Reports |