| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sequoia Research Products Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Name | 1,4,5,8-Tetrahydroxy-2-Methyl-9,10-Anthracenedione |
|---|---|
| Synonyms | 1,4,5,8-Tetrahydroxy-2-Methyl-Anthracene-9,10-Dione; 1,4,5,8-Tetrahydroxy-2-Methyl-9,10-Anthraquinone; Nsc114343 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| CAS Registry Number | 476-43-7 |
| SMILES | C1=C(C(=C2C(=C1O)C(C3=C(C2=O)C(=CC=C3O)O)=O)O)C |
| InChI | 1S/C15H10O6/c1-5-4-8(18)11-12(13(5)19)15(21)10-7(17)3-2-6(16)9(10)14(11)20/h2-4,16-19H,1H3 |
| InChIKey | NFQXCHAJWVRYND-UHFFFAOYSA-N |
| Density | 1.693g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.838°C at 760 mmHg (Cal.) |
| Flash point | 318.517°C (Cal.) |
| (1) | Assante Gemma, Locci Romano, Camarda Lorenzo, Merlini Lucio, Nasini Gianluca. Screening of the genus Cercospora for secondary metabolites☆, Phytochemistry, 1977 |
|---|---|
| Market Analysis Reports |