|
CAS#: 4762-50-9 Product: Phenylphosphonic acid compound with aniline No suppilers available for the product. |
| Name | Phenylphosphonic acid compound with aniline |
|---|---|
| Synonyms | Phenylamine; Phenylphosphonic Acid; Ncgc00013652; Nsc-52927 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14NO3P |
| Molecular Weight | 251.22 |
| CAS Registry Number | 4762-50-9 |
| SMILES | C1=C([P](O)(O)=O)C=CC=C1.C2=C(N)C=CC=C2 |
| InChI | 1S/C6H7N.C6H7O3P/c7-6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6/h1-5H,7H2;1-5H,(H2,7,8,9) |
| InChIKey | SDEUFAJBZNDTEW-UHFFFAOYSA-N |
| Boiling point | 353.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 167.7°C (Cal.) |
| Market Analysis Reports |