| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Apexmol Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (10) 8290-0393 | |||
![]() |
sales@apexmol.com | |||
| Chemical manufacturer since 2012 | ||||
| Name | Aporphine |
|---|---|
| Synonyms | 6-Methyl-5,6,6A,7-Tetrahydro-4H-Dibenzo[De,G]Quinoline; Chebi:35643; 4H-Dibenzo(De,G)Quinoline, 5,6,6A,7-Tetrahydro-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 |
| CAS Registry Number | 478-57-9 |
| SMILES | C1=C3C2=C(C=C1)CCN(C2CC4=CC=CC=C34)C |
| InChI | 1S/C17H17N/c1-18-10-9-12-6-4-8-15-14-7-3-2-5-13(14)11-16(18)17(12)15/h2-8,16H,9-11H2,1H3 |
| InChIKey | BZKUYNBAFQJRDM-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.258°C at 760 mmHg (Cal.) |
| Flash point | 160.499°C (Cal.) |
| (1) | Qiaoxia Liu, Shiyi Qiu, Hui Yu, Yanxiong Ke, Yu Jin and Xinmiao Liang. Selective separation of structure-related alkaloids in Rhizoma coptidis with “click” binaphthyl stationary phase and their structural elucidation with liquid chromatography-mass spectrometry, Analyst, 2011, 136, 4357. |
|---|---|
| Market Analysis Reports |