Online Database of Chemicals from Around the World
Methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
[CAS 478375-39-2]
Identification| Name | Methyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C15H21BO4 |
| Molecular Weight | 276.14 |
| CAS Registry Number | 478375-39-2 |
| EC Number | 854-746-4 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)C(=O)OC |
|
Properties
| Solubility | 104.2 mg/L (25 °C water) |
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.498, Calc.* |
| Melting point | 105.33 °C |
| Boiling Point | 332.89 °C, 370.4±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 177.8±25.9 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Eye irritation | Eye Irrit. | 2A | H319 |
| Skin irritation | Skin Irrit. | 2 | H315 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
|
Related Products