| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Name | 5,6-Dihydroxy-1H-Indole-2-Carboxylic Acid |
|---|---|
| Synonyms | Aids-356387; Aids356387; 5,6-Dihydroxyindole-2-Carboxylate |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 4790-08-3 |
| SMILES | C1=C([NH]C2=C1C=C(O)C(=C2)O)C(=O)O |
| InChI | 1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14) |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-N |
| Density | 1.736g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.644°C at 760 mmHg (Cal.) |
| Flash point | 303.753°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Andrew A. R. Watt, Jacques P. Bothma and Paul Meredith. The supramolecular structure of melanin, Soft Matter, 2009, 5, 3754. |
|---|---|
| Market Analysis Reports |