| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Name | 6'-Hydroxy-3-Oxo-3H-Spiro[2-Benzofuran-1,9'-Xanthen]-3'-Yl Methacrylate |
|---|---|
| Synonyms | 3'-Methacryloxyspirobenzo[c]-furan[1,9']xanthen-3-one; Fluorescein O-methacrylate; Methacryloyloxy fluorescein |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.38 |
| CAS Registry Number | 480439-15-4 |
| SMILES | CC(=C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)O)C5=CC=CC=C5C(=O)O3 |
| InChI | 1S/C24H16O6/c1-13(2)22(26)28-15-8-10-19-21(12-15)29-20-11-14(25)7-9-18(20)24(19)17-6-4-3-5-16(17)23(27)30-24/h3-12,25H,1H2,2H3 |
| InChIKey | YMHPNLUYVDEYCI-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 636.6±55.0°C at 760 mmHg (Cal.) |
| Flash point | 226.3±25.0°C (Cal.) |
| Refractive index | 1.708 (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| SDS | Available |
| (1) | Louis Moreau, Alexia Balland-Longeau, Philippe Mazabraud, Alain Duchêne and Jérôme Thibonnet. Supramolecular and core–shell materials from self-assembled fibers, Chem. Commun., 2010, 46, 1464. |
|---|---|
| Market Analysis Reports |