Online Database of Chemicals from Around the World
2,3,4,5,6-Pentamethylbenzyl chloride
[CAS 484-65-1]
Identification| Name | 2,3,4,5,6-Pentamethylbenzyl chloride |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 |
| CAS Registry Number | 484-65-1 |
| EC Number | 207-608-7 |
| SMILES | CC1=C(C(=C(C(=C1C)C)CCl)C)C |
|
Properties
| Solubility | 0.8598 mg/L (25 °C water) |
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.518, Calc.* |
| Melting point | 59.12 °C |
| Boiling Point | 295.1±9.0 °C (760 mmHg), Calc.*, 275.93 °C |
| Flash Point | 128.2±11.4 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS05 Danger Details |
| Risk Statements | H314-H318 Details |
| Safety Statements | P260-P264-P264+P265-P280-P301+P330+P331-P302+P361+P354-P304+P340-P305+P354+P338-P316-P317-P321-P363-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Skin corrosion | Skin Corr. | 1B | H314 |
| Serious eye damage | Eye Dam. | 1 | H318 |
| Substances or mixtures corrosive to metals | Met. Corr. | 1 | H290 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
| Skin corrosion | Skin Corr. | 1C | H314 |
|
| SDS | Available |
|
Related Products
Pentamethylbenz... 2,4,5,6,7-Penta... 2,2,4,5,6-Penta... 2,2,4,5,7-Penta... Pentamethylbenz... Pentamethylbenz... 2,2,6,6,10-Pent... 2-(2,3,4,5,6-Pe... 2,3,4,5,6-Penta... 2,3,4,5,6-Penta... (Pentamethylben... N,N,1,7,7-Penta... 2,2,5,8,8-Penta... 1,1,3,5,5-Penta... (2S)-N,N,N',N',... 1,4,5,8,9-Penta... 2,2,5,7,8-Penta... N,N,2,6,8-Penta... 2,2,5,7,8-Penta... 2,2,5,7,8-Penta...