| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Life Chemicals Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (905) 634-5212 | |||
![]() |
lifechemicals@lifechemicals.com | |||
| Chemical manufacturer since 2004 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 3-Benzoylbenzo [f] Coumarin |
|---|---|
| Synonyms | 2-(Oxo-Phenylmethyl)-3-Benzo[F]Chromenone; 2-Phenylcarbonylbenzo[F]Chromen-3-One; Zinc00162119 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O3 |
| Molecular Weight | 300.31 |
| CAS Registry Number | 4852-81-7 |
| SMILES | C1=CC=CC2=CC=C4C(=C12)C=C(C(C3=CC=CC=C3)=O)C(O4)=O |
| InChI | 1S/C20H12O3/c21-19(14-7-2-1-3-8-14)17-12-16-15-9-5-4-6-13(15)10-11-18(16)23-20(17)22/h1-12H |
| InChIKey | JPPGTVYDWHSNLJ-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.961°C at 760 mmHg (Cal.) |
| Flash point | 239.087°C (Cal.) |
| (1) | K. C. Majumdar, Srikanta Samanta, Inul Ansary and B. Roy. An unusual one-pot synthesis of 3-benzoylcoumarins and coumarin-3-carbaldehydes from 2-hydroxybenzaldehydes under esterification conditions, RSC Advances, 2012, 2, 2137. |
|---|---|
| Market Analysis Reports |