| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | Isopropyl Phenylacetate |
| Synonyms | Isopropyl 2-Phenylacetate; 2-Phenylacetic Acid Isopropyl Ester; Propan-2-Yl 2-Phenylethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 4861-85-2 |
| EINECS | 225-468-5 |
| FEMA | 2956 |
| SMILES | C1=CC(=CC=C1)CC(OC(C)C)=O |
| InChI | 1S/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | SSMBXPJYHMZLOJ-UHFFFAOYSA-N |
| Density | 1.01 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Boiling point | 237.7±9.0°C at 760 mmHg (Cal.) |
| 238-253°C (Expl.) | |
| Flash point | 107°C (Expl.) |
| 97.5±17.1°C (Cal.) | |
| Refractive index | 1.488 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |