| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,2',2'-Nitrilotris-Acetamide |
|---|---|
| Synonyms | 2-[Bis(2-Amino-2-Oxo-Ethyl)Amino]Acetamide; 2-[Bis(2-Amino-2-Keto-Ethyl)Amino]Acetamide; 2-[Bis(2-Amino-2-Oxo-Ethyl)Amino]Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 |
| CAS Registry Number | 4862-18-4 |
| EINECS | 225-469-0 |
| SMILES | C(C(=O)N)N(CC(=O)N)CC(=O)N |
| InChI | 1S/C6H12N4O3/c7-4(11)1-10(2-5(8)12)3-6(9)13/h1-3H2,(H2,7,11)(H2,8,12)(H2,9,13) |
| InChIKey | CVTGEDNIBVTKBJ-UHFFFAOYSA-N |
| Density | 1.371g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.311°C at 760 mmHg (Cal.) |
| Flash point | 302.947°C (Cal.) |
| (1) | E. Skrzypczak-Jankun and D. A. Smith. Complexes of HgCl2 and HgBr2 with nitrilotriacetamide, Acta Cryst. (1994). C50, 1585-1588 |
|---|---|
| Market Analysis Reports |