Online Database of Chemicals from Around the World

1,3-Dimethyluracil-5-carboxaldehyde
[CAS 4869-46-9]

List of Suppliers
Tianjin Zhongxin Chem-tech Co., Ltd. China
www.tjzxchem.com
+86 (22) 6688-0623
+86 (22) 8988-0739 ex 8030
sales@tjzxchem.com
Chemical manufacturer since 2007
chemBlink Standard supplier since 2009

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Urinary (urea) pyrimidine
Name1,3-Dimethyluracil-5-carboxaldehyde
Molecular Structure1,3-Dimethyluracil-5-carboxaldehyde molecular structure (CAS 4869-46-9)
Molecular FormulaC7H8N2O3
Molecular Weight168.15
CAS Registry Number4869-46-9
EC Number676-471-7
SMILESCN1C=C(C(=O)N(C1=O)C)C=O
Properties
Solubility6901 mg/L (25 °C water)
Density1.4±0.1 g/cm3, Calc.*
Index of Refraction1.611, Calc.*
Melting point135.86 °C
Boiling Point274.1±50.0 °C (760 mmHg), Calc.*, 365.12 °C
Flash Point122.6±22.5 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin irritationSkin Irrit.2H315
Eye irritationEye Irrit.2AH319
Specific target organ toxicity - single exposureSTOT SE3H335
SDSAvailable
up Discovery and Applications
1,3-Dimethyluracil-5-carboxaldehyde is a significant compound within the realm of organic chemistry and medicinal chemistry, primarily recognized for its diverse applications and potential therapeutic benefits. The substance is a derivative of uracil, a naturally occurring pyrimidine base found in nucleic acids. The discovery of 1,3-Dimethyluracil-5-carboxaldehyde can be traced back to the mid-20th century when researchers began exploring modified uracil compounds for their biological activities and potential pharmaceutical applications.

The chemical structure of 1,3-Dimethyluracil-5-carboxaldehyde features a uracil skeleton with two methyl groups at the 1 and 3 positions and an aldehyde group at the 5 position. This modification not only alters the compound's solubility and stability but also enhances its reactivity, making it a valuable precursor for further chemical transformations. The synthesis of 1,3-Dimethyluracil-5-carboxaldehyde typically involves multi-step organic reactions, including oxidation and condensation processes that enable the introduction of functional groups into the uracil framework.

One of the primary applications of 1,3-Dimethyluracil-5-carboxaldehyde lies in the field of medicinal chemistry, where it has been investigated for its antiviral properties. The compound has shown promise as a potential antiviral agent due to its ability to inhibit viral replication and affect viral polymerases. Studies have indicated that derivatives of 1,3-Dimethyluracil-5-carboxaldehyde can act against various viruses, including those that cause respiratory infections and other viral diseases. This has led to ongoing research into its efficacy and mechanisms of action, positioning the compound as a candidate for further development in antiviral therapeutics.

In addition to its antiviral properties, 1,3-Dimethyluracil-5-carboxaldehyde has been explored for its potential applications in cancer treatment. The compound has been shown to exhibit cytotoxic effects on certain cancer cell lines, prompting investigations into its mechanism of action and possible use in combination therapies. The ability to selectively target cancer cells while minimizing harm to healthy cells is a key focus of current cancer research, and compounds like 1,3-Dimethyluracil-5-carboxaldehyde contribute valuable insights into this pursuit.

Moreover, 1,3-Dimethyluracil-5-carboxaldehyde serves as a versatile building block in organic synthesis. Its unique functional groups allow it to participate in various chemical reactions, enabling the creation of more complex molecules. This versatility makes it an essential compound in the development of new materials and pharmaceuticals, contributing to advancements in drug discovery and formulation.

The compound also finds utility in the field of biochemistry, where it may be used as a biochemical probe to study enzyme activities related to nucleic acid metabolism. Understanding how such compounds interact with enzymes involved in nucleotide synthesis and degradation can provide valuable insights into cellular processes and potential therapeutic targets.

Safety considerations are paramount in the handling and use of 1,3-Dimethyluracil-5-carboxaldehyde. Appropriate safety measures should be in place to minimize exposure, and research involving the compound should adhere to regulatory guidelines governing the use of chemical substances in laboratories and pharmaceutical applications.

In summary, 1,3-Dimethyluracil-5-carboxaldehyde is a compound of significant interest in the fields of medicinal chemistry and organic synthesis. Its discovery has opened avenues for research into antiviral and anticancer therapies, while its versatility in organic synthesis underscores its importance in the development of novel materials and pharmaceuticals. Ongoing research into the compound's properties and potential applications continues to contribute to advancements in various scientific disciplines.

References

2021. Efficient Route for the Synthesis of Diverse Heteroannelated 5-Cyanopyridines. Synthesis, 53(8).
DOI: 10.1055/a-1360-9852

2009. Recyclization Reactions of 5-Formyl-1,3-dimethyluracil with Electron-Rich Amino Heterocycles. Synthesis, 2009(11).
DOI: 10.1055/s-0029-1216798

2018. Synthesis and Cytotoxic Activity of Conjugates of (-)-Cytisine and Thermopsin Amine Derivatives with 1,3-Dimethyl-5-Formyluracil. Chemistry of Natural Compounds, 54(5).
DOI: 10.1007/s10600-018-2517-6
Market Analysis Reports
Related Products
6,10-Dimethyl-3...  N,N-Dimethyl-10...  6,10-Dimethylun...  6,10-Dimethyl-5...  6,10-Dimethylun...  Dimethyl(Undecy...  4,4-Dimethyl-2-...  2,5-Dimethyl-1-...  3,5-Dimethylura...  1,3-Dimethylura...  1,3-DiMethylura...  Dimethyl Urea  1,1-Dimethylure...  1,3-Dimethylure...  4-(3-Dimethylur...  1,7-Dimethyluri...  1,3-Dimethyluri...  1,7-Dimethyluri...  5,2'-O-Dimethyl...  3,4-Dimethylval...