| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Synchem OHG | Germany | |||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | Isoelemicin |
|---|---|
| Synonyms | 1,2,3-Trimethoxy-5-Prop-1-Enylbenzene; 1,2,3-Trimethoxy-5-Prop-1-Enyl-Benzene; 1,2,3-Trimethoxy-5-[(1E)-1-Propenyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 487-12-7 |
| SMILES | C1=C(C=C(C(=C1OC)OC)OC)\C=C\C |
| InChI | 1S/C12H16O3/c1-5-6-9-7-10(13-2)12(15-4)11(8-9)14-3/h5-8H,1-4H3/b6-5+ |
| InChIKey | RRXOQHQFJOQLQR-AATRIKPKSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.454°C at 760 mmHg (Cal.) |
| Flash point | 102.178°C (Cal.) |
| (1) | Lee Ai-Lan, Ley Steven V.. The synthesis of the anti-malarial natural product polysphorin and analogues using polymer-supported reagents and scavengers, Organic & Biomolecular Chemistry, 2003 |
|---|---|
| Market Analysis Reports |