| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| MicroCombiChem e.K. | UK | |||
|---|---|---|---|---|
![]() |
+49 (611) 962-5284 | |||
![]() |
info@microcombichem.com | |||
| Chemical manufacturer | ||||
| Natural Remedies Pvt Ltd | India | |||
|---|---|---|---|---|
![]() |
+91 (80) 4020-9999 | |||
![]() |
sendhil@naturalremedy.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,2,4-Trimethoxy-5-Propenylbenzene |
|---|---|
| Synonyms | 1,2,4-Trimethoxy-5-[(E)-Prop-1-Enyl]Benzene; 1,2,4-Trimethoxy-5-Prop-1-Enyl-Benzene; Benzene, 1,2,4-Trimethoxy-5-(1-Propenyl)-, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 494-40-6 |
| EINECS | 207-788-7 |
| SMILES | C1=C(C(=CC(=C1OC)OC)\C=C\C)OC |
| InChI | 1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+ |
| InChIKey | RKFAZBXYICVSKP-AATRIKPKSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 57-61°C (Expl.) |
| Boiling point | 296°C (Expl.) |
| 295.999°C at 760 mmHg (Cal.) | |
| Flash point | 107.7±23.8°C (Cal.) |
| (1) | Anna Michrowska, Łukasz Gułajski and Karol Grela. A simple and practical phase-separation approach to the recycling of a homogeneous metathesis catalyst, Chem. Commun., 2006, 0, 841. |
|---|---|
| Market Analysis Reports |