| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Furan and pyran |
|---|---|
| Name | 1,9-Nonanediol Diacetate |
| Synonyms | 9-Acetoxynonyl Acetate; Acetic Acid 9-Acetoxynonyl Ester; 9-Acetyloxynonyl Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 |
| CAS Registry Number | 4944-60-9 |
| SMILES | C(OC(=O)C)CCCCCCCCOC(=O)C |
| InChI | 1S/C13H24O4/c1-12(14)16-10-8-6-4-3-5-7-9-11-17-13(2)15/h3-11H2,1-2H3 |
| InChIKey | JAEVCKMMGIFOCL-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.728°C at 760 mmHg (Cal.) |
| Flash point | 129.202°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |