| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Nitrobenzyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid (2-Nitrophenyl)Methyl Ester; Acrylic Acid (2-Nitrobenzyl) Ester; 2-Nitrobenzyl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 49594-70-9 |
| EINECS | 256-394-1 |
| SMILES | C1=CC=CC(=C1[N+]([O-])=O)COC(=O)C=C |
| InChI | 1S/C10H9NO4/c1-2-10(12)15-7-8-5-3-4-6-9(8)11(13)14/h2-6H,1,7H2 |
| InChIKey | CVTDDZYPSGYVNN-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.462°C at 760 mmHg (Cal.) |
| Flash point | 134.723°C (Cal.) |
| (1) | Vyas V. Ramanan, Joshua S. Katz, Murat Guvendiren, Eric R. Cohen, Ross A. Marklein and Jason A. Burdick. Photocleavable side groups to spatially alter hydrogel properties and cellular interactions, J. Mater. Chem., 2010, 20, 8920. |
|---|---|
| Market Analysis Reports |