| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| HetCat - Heterocycles & Catalysts | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (61) 363-9868 | |||
![]() |
fallahpour@hetcat.com | |||
| Chemical manufacturer | ||||
| Name | 1,1'-(2,2'-Bipyridine-6,6'-Diyl)Diethanone |
|---|---|
| Synonyms | 6,6′-diacetyl-2,2′-bipyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 49669-27-4 |
| SMILES | CC(=O)C1=CC=CC(=N1)C2=NC(=CC=C2)C(=O)C |
| InChI | 1S/C14H12N2O2/c1-9(17)11-5-3-7-13(15-11)14-8-4-6-12(16-14)10(2)18/h3-8H,1-2H3 |
| InChIKey | KYXBCPWHTPLSPY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 213.0±35.1°C (Cal.) |
| (1) | Gerry A. Griffith, Mohamed J. Al-Khatib, Kalpana Patel, Kuldip Singh and Gregory A. Solan. Solid and solution state flexibility of sterically congested bis(imino)bipyridine complexes of zinc(ii) and nickel(ii), Dalton Trans., 2009, 185. |
|---|---|
| Market Analysis Reports |