| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 5,5-Diethyl-1-methylbarbituric acid |
|---|---|
| Synonyms | 5,5-Diethyl-1-Methyl-Hexahydropyrimidine-2,4,6-Trione; 5,5-Diethyl-1-Methylhexahydropyrimidine-2,4,6-Trione; 5,5-Diethyl-1-Methyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 50-11-3 |
| EINECS | 200-011-2 |
| SMILES | C(C1(C(NC(N(C1=O)C)=O)=O)CC)C |
| InChI | 1S/C9H14N2O3/c1-4-9(5-2)6(12)10-8(14)11(3)7(9)13/h4-5H2,1-3H3,(H,10,12,14) |
| InChIKey | FWJKNZONDWOGMI-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |