| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4-n-Nonyloxybenzaldehyde |
|---|---|
| Synonyms | Sbb007813; Fr-0386; P-Nonyloxybenzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 50262-46-9 |
| SMILES | C1=CC(=CC=C1OCCCCCCCCC)C=O |
| InChI | 1S/C16H24O2/c1-2-3-4-5-6-7-8-13-18-16-11-9-15(14-17)10-12-16/h9-12,14H,2-8,13H2,1H3 |
| InChIKey | OZWJLGGZWZZBKK-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 180-182°C (Expl.) |
| 364.8±15.0°C at 760 mmHg (Cal.) | |
| Flash point | 146.9±13.9°C (Cal.) |
| Refractive index | 1.519 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |