| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 1,1'-(1,4-Butanediyl)Dibenzene |
|---|---|
| Synonyms | (4-phenylbutyl)benzene; (4-Phenylbutyl)benzene #; 1,1'-(1,4-Butanediyl)bisbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.31 |
| CAS Registry Number | 51001-35-5 |
| SMILES | C1=CC=C(C=C1)CCCCC2=CC=CC=C2 |
| InChI | 1S/C16H18/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | GLJFYGFBITUZOE-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.1±12.0°C at 760 mmHg (Cal.) |
| Flash point | 151.3±10.3°C (Cal.) |
| (1) | Stefan Grimme, Christian Mück-Lichtenfeld and Jens Antony. Analysis of non-covalent interactions in (bio)organic molecules using orbital-partitioned localized MP2, Phys. Chem. Chem. Phys., 2008, 10, 3327. |
|---|---|
| Market Analysis Reports |