|
CAS#: 51246-94-7 Product: 1,5-Anhydroarabinofuranose No suppilers available for the product. |
| Name | 1,5-Anhydroarabinofuranose |
|---|---|
| Synonyms | 1,5-Anhydro-Beta-L-Arabinofuranose; 1,5-Anhydroarabinofuranose; Beta-L-Arabinofuranose, 1,5-Anhydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 |
| CAS Registry Number | 51246-94-7 |
| SMILES | [C@@H]12O[C@@H]([C@H](O)[C@H]1O)CO2 |
| InChI | 1S/C5H8O4/c6-3-2-1-8-5(9-2)4(3)7/h2-7H,1H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | OYJJPEGOLXZHDM-KKQCNMDGSA-N |
| Density | 1.626g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.841°C at 760 mmHg (Cal.) |
| Flash point | 146.63°C (Cal.) |
| (1) | Miura Masakatsu, Kaga Harumi, Yoshida Takashi, Ando Koji. Microwave pyrolysis of cellulosic materials for the production of anhydrosugars, Journal of Wood Science, 2001 |
|---|---|
| Market Analysis Reports |