| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Name | beta,beta-Carotene-3,3',4,4'-Tetrone |
|---|---|
| Synonyms | astacene |
| Molecular Structure | ![]() |
| Molecular Formula | C40H48O4 |
| Molecular Weight | 592.81 |
| CAS Registry Number | 514-76-1 |
| SMILES | CC1=C(C(CC(=O)C1=O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(C(=O)C(=O)CC2(C)C)C)\C)\C)/C)/C |
| InChI | 1S/C40H48O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+ |
| InChIKey | RASZIXQTZOARSV-QISQUURKSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 735.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 298.3±28.1°C (Cal.) |
| (1) | Luiza Helena Gremski, Rafael Bertoni da Silveira, Olga Meiri Chaim, Christian Macagnan Probst, Valéria Pereira Ferrer, Jenifer Nowatzki, Hellen Chris Weinschutz, Humberto Maciel Madeira, Waldemiro Gremski, Helena Bonciani Nader, Andrea Senff-Ribeiro and Silvio Sanches Veiga. A novel expression profile of the Loxosceles intermedia spider venomous gland revealed by transcriptome analysis, Mol. Biosyst., 2010, 6, 2403. |
|---|---|
| Market Analysis Reports |