|
CAS#: 51415-07-7 Product: Momilactone A No suppilers available for the product. |
| Name | Momilactone A |
|---|---|
| Synonyms | Momilacton A; Momilactone A |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 51415-07-7 |
| SMILES | [C@@]34([C@H]2[C@]([C@@H]1CC[C@](CC1=C[C@H]2OC3=O)(C=C)C)(C)CCC4=O)C |
| InChI | 1S/C20H26O3/c1-5-18(2)8-6-13-12(11-18)10-14-16-19(13,3)9-7-15(21)20(16,4)17(22)23-14/h5,10,13-14,16H,1,6-9,11H2,2-4H3/t13-,14-,16-,18-,19-,20+/m1/s1 |
| InChIKey | MPHXYQVSOFGNEN-JGHPTVLTSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.118°C at 760 mmHg (Cal.) |
| Flash point | 201.846°C (Cal.) |
| (1) | Keiko Yonekura-Sakakibara and Kazuki Saito. Functional genomics for plant natural productbiosynthesis, Nat. Prod. Rep., 2009, 26, 1466. |
|---|---|
| Market Analysis Reports |