| Acesys Pharmatech | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| Arran Chemical Company | Ireland | |||
|---|---|---|---|---|
![]() |
+353 (90) 644-5700 | |||
![]() |
info@arranchemical.ie | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | (S)-(-)-1-(1-Naphthyl)Ethylamine Hydrochloride |
| Synonyms | (S)-(-)-1-(1-NAPHTHYL)ETHYLAMINE HYDROCHLORIDE,97%; (S)-(-)-1-(1-NAPHTHYL)ETHYLAMINE HYDROC&; (S)-(-)-1-(1-Naphthyl)Ethylamine Hcl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 |
| CAS Registry Number | 51600-24-9 |
| SMILES | C[C@@H](c1cccc2c1cccc2)N.Cl |
| InChI | 1S/C12H13N.ClH/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9H,13H2,1H3;1H/t9-;/m0./s1 |
| Market Analysis Reports |