| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Estrogen and progestogen drugs |
|---|---|
| Name | Methallenestril |
| Synonyms | 3-(6-Methoxy-2-Naphthyl)-2,2-Dimethyl-Pentanoic Acid; 3-(6-Methoxy-2-Naphthyl)-2,2-Dimethylpentanoic Acid; 3-(6-Methoxy-2-Naphthyl)-2,2-Dimethyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 |
| CAS Registry Number | 517-18-0 |
| EINECS | 208-232-6 |
| SMILES | C1=C(C(C(C(O)=O)(C)C)CC)C=CC2=CC(=CC=C12)OC |
| InChI | 1S/C18H22O3/c1-5-16(18(2,3)17(19)20)14-7-6-13-11-15(21-4)9-8-12(13)10-14/h6-11,16H,5H2,1-4H3,(H,19,20) |
| InChIKey | KHLJKRBMZVNZOC-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.965°C at 760 mmHg (Cal.) |
| Flash point | 154.723°C (Cal.) |
| Market Analysis Reports |