| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Spectrum Info Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 573-5462 | |||
![]() |
spec-info@spec-info.com | |||
| Chemical manufacturer | ||||
| Name | 9,9'-Dixanthylidene |
|---|---|
| Synonyms | 9-(9-Xanthenylidene)Xanthene; Dixanthylidene; Nsc15906 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H16O2 |
| Molecular Weight | 360.41 |
| CAS Registry Number | 517-45-3 |
| EINECS | 208-241-5 |
| SMILES | C1=CC=CC5=C1C(=C2C4=C(OC3=C2C=CC=C3)C=CC=C4)C6=C(O5)C=CC=C6 |
| InChI | 1S/C26H16O2/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)27-21)26-19-11-3-7-15-23(19)28-24-16-8-4-12-20(24)26/h1-16H |
| InChIKey | SXXWAWNPJCEOGD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 318-320°C (Expl.) |
| Boiling point | 494.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 188.4±28.3°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| (1) | Mao Mao, Qing-Qing Wu, Ming-Guang Ren and Qin-Hua Song. Highly efficient and regiospecific photocyclization of 2,2′-diacyl bixanthenylidenes, Org. Biomol. Chem., 2011, 9, 3165. |
|---|---|
| Market Analysis Reports |