| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Cosmetic standard |
|---|---|
| Name | Pyranocoumarin |
| Synonyms | 2H,5H-Pyrano[3,2-C][1]Benzopyran-5-One, 3,4-Dihydro-2-Methoxy-2-Methyl-4-Phenyl-; Ncgc00166195-01; 45647_Riedel |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 |
| CAS Registry Number | 518-20-7 |
| EINECS | 208-248-3 |
| SMILES | C1=CC=CC4=C1C3=C(C(C2=CC=CC=C2)CC(O3)(OC)C)C(O4)=O |
| InChI | 1S/C20H18O4/c1-20(22-2)12-15(13-8-4-3-5-9-13)17-18(24-20)14-10-6-7-11-16(14)23-19(17)21/h3-11,15H,12H2,1-2H3 |
| InChIKey | ZGFASEKBKWVCGP-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.614°C at 760 mmHg (Cal.) |
| Flash point | 216.213°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ene Jin Jung, Byung Ho Park and Yong Rok Lee. Environmentally benign, one-pot synthesis of pyrans by domino Knoevenagel/6π-electrocyclization in water and application to natural products, Green Chem., 2010, 12, 2003. |
|---|---|
| Market Analysis Reports |