| Amadis Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8992-5085 | |||
![]() |
sales@amadischem.com | |||
![]() |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (-)-Morphine hydrochloride |
|---|---|
| Synonyms | Morphinan-3,6-Diol, 7,8-Didehydro-4,5-Epoxy-17-Methyl-, (5Alpha,6Alpha)-, Hydrochloride; Ampek |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 |
| CAS Registry Number | 52-26-6 |
| EINECS | 200-136-2 |
| SMILES | [C@]124[C@@H]5[C@H](N(CC1)C)CC3=C2C(=C(O)C=C3)O[C@H]4[C@@H](O)C=C5.[H+].[Cl-] |
| InChI | 1S/C17H19NO3.ClH/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;/h2-5,10-11,13,16,19-20H,6-8H2,1H3;1H/t10-,11+,13-,16-,17-;/m0./s1 |
| InChIKey | XCKKIKBIPZJUET-VYKNHSEDSA-N |
| Boiling point | 476.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 241.8°C (Cal.) |
| (1) | Artem U. Kulikov, Alexander P. Boichenko and Aleksey G. Verushkin. Optimization of micellar LC conditions for separation of opium alkaloids and their determination in pharmaceutical preparations, Anal. Methods, 2011, 3, 2749. |
|---|---|
| Market Analysis Reports |