| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Ethylanthracene |
|---|---|
| Synonyms | Ethylanthracene; Anthracene, 2-Ethyl- |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 52251-71-5 |
| EINECS | 257-788-6 |
| SMILES | C2=C1C=CC=CC1=CC3=CC=C(C=C23)CC |
| InChI | 1S/C16H14/c1-2-12-7-8-15-10-13-5-3-4-6-14(13)11-16(15)9-12/h3-11H,2H2,1H3 |
| InChIKey | ZXAGXLDEMUNQSH-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.263°C at 760 mmHg (Cal.) |
| Flash point | 165.139°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |