Online Database of Chemicals from Around the World

1,2-Dimethyl-4-phenyl-1H-pyrrole
[CAS 52266-24-7]

List of Suppliers
Chizhou Dongsheng Pharmaceutical Co., Ltd. China
www.dspharmchem.com
+86 (576) 8429-2571
+86 (576) 8429-2560
ksz@dspharmchem.com
Chemical manufacturer since 1995
chemBlink Premium supplier since 2011
Identification
ClassificationOrganic raw materials >> Heterocyclic compound >> Pyrroles
Name1,2-Dimethyl-4-phenyl-1H-pyrrole
Molecular Structure1,2-Dimethyl-4-phenyl-1H-pyrrole molecular structure (CAS 52266-24-7)
Molecular FormulaC12H13N
Molecular Weight171.24
CAS Registry Number52266-24-7
SMILESCC1=CC(=CN1C)C2=CC=CC=C2
Properties
Melting point48 - 49 °C
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P271-P280-P302-P304-P305-P313-P332-P337-P338-P340-P351-P352  Details
up Discovery and Applications
1,2-Dimethyl-4-phenyl-1H-pyrrole is an important organic compound with notable applications in both pharmaceutical and chemical industries. Characterized by its pyrrole ring system substituted with methyl and phenyl groups, this compound exemplifies how structural modifications can influence chemical reactivity and functionality.

The discovery of 1,2-dimethyl-4-phenyl-1H-pyrrole is rooted in the broader study of pyrrole derivatives, which have long been of interest due to their diverse biological and chemical properties. Pyrrole itself is a five-membered aromatic heterocycle with a nitrogen atom, and its derivatives are known for their role in various natural products and synthetic compounds. The synthesis of 1,2-dimethyl-4-phenyl-1H-pyrrole involves functionalizing the pyrrole ring with methyl and phenyl groups, which can be achieved through several synthetic strategies, including the condensation of appropriate precursors under controlled conditions.

The applications of 1,2-dimethyl-4-phenyl-1H-pyrrole span several fields, particularly in medicinal chemistry and materials science. In medicinal chemistry, this compound has been explored for its potential biological activity. Pyrrole derivatives are known to exhibit a range of pharmacological effects, including antimicrobial, anticancer, and anti-inflammatory activities. The presence of the phenyl and methyl substituents in 1,2-dimethyl-4-phenyl-1H-pyrrole can influence its interaction with biological targets, potentially leading to the development of novel therapeutic agents.

One notable application of 1,2-dimethyl-4-phenyl-1H-pyrrole is in the synthesis of pharmaceutical compounds. Researchers have investigated its use as a building block for creating more complex molecules with desirable biological properties. By modifying the pyrrole ring or introducing additional functional groups, chemists can tailor the compound for specific therapeutic uses. For example, modifications to the pyrrole structure could enhance its binding affinity for particular enzymes or receptors, thereby improving its efficacy as a drug candidate.

In addition to its pharmaceutical applications, 1,2-dimethyl-4-phenyl-1H-pyrrole has potential uses in materials science. The compound's unique structure makes it a candidate for incorporation into functional materials such as organic semiconductors or dyes. Its electronic properties, influenced by the presence of the phenyl group and the pyrrole ring, can be harnessed for applications in electronic devices or as a colorant in various products.

The synthesis of 1,2-dimethyl-4-phenyl-1H-pyrrole typically involves the use of reagents and catalysts that facilitate the introduction of the methyl and phenyl groups onto the pyrrole ring. The synthetic route may vary depending on the desired yield and purity of the final product. Techniques such as chromatography and spectroscopy are employed to characterize the compound and confirm its structure.

Overall, 1,2-dimethyl-4-phenyl-1H-pyrrole is a versatile compound with significant applications in drug discovery and materials science. Its synthesis and use demonstrate the importance of structural modifications in developing new chemical entities with specific properties and applications.

References

2013. Paal-Knorr-Type Cyclizative Condensation. Science of Synthesis.
URL: https://science-of-synthesis.thieme.com/app/text/?id=SD-109-00393
Market Analysis Reports
Related Products
(2,5-Dimethylph...  (2,4-Dimethylph...  (2,5-Dimethylph...  (2,6-Dimethylph...  (3,5-Dimethylph...  N,N-Dimethyl-3-...  4,5-Dimethyl-2-...  2,4-Dimethyl-6-...  3,6-Dimethyl-2-...  2,6-Dimethyl-3-...  2,5-Dimethyl-1-...  1-(2,3-Dimethyl...  1-(2,4-Dimethyl...  1-(2,5-Dimethyl...  1-(3,5-Dimethyl...  1-(3,4-Dimethyl...  2,5-Dimethyl-1-...  2,5-Dimethyl-1-...  1-(2,4-Dimethyl...  1-(2,6-Dimethyl...