| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 2,2-Dimethyl-2,6-dihydro-pyrano[3,2-c]quinolin-5-one |
|---|---|
| Synonyms | 5H-Pyrano[3,2-C]Quinolin-5-One, 2,6-Dihydro-2,2-Dimethyl-; Nsc94655; 2,2-Dimethyl-2,6-Dihydro-Pyrano[3,2-C]Quinolin-5-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 523-64-8 |
| SMILES | C1=CC=CC2=C1C3=C(C(=O)N2)C=CC(O3)(C)C |
| InChI | 1S/C14H13NO2/c1-14(2)8-7-10-12(17-14)9-5-3-4-6-11(9)15-13(10)16/h3-8H,1-2H3,(H,15,16) |
| InChIKey | PXNMNABLQWUMCX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 220.5±28.7°C (Cal.) |
| (1) | Ramesh M. A convenient synthesis of flindersine, atanine and their analogues, Tetrahedron, 1984 |
|---|---|
| Market Analysis Reports |