| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Ethyl 2-Acetoxybenzoate |
| Synonyms | Ethyl 2-Acetoxybenzoate; 2-Acetoxybenzoic Acid Ethyl Ester; Ai3-05003 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 529-68-0 |
| EINECS | 208-467-4 |
| SMILES | C1=CC=CC(=C1OC(C)=O)C(OCC)=O |
| InChI | 1S/C11H12O4/c1-3-14-11(13)9-6-4-5-7-10(9)15-8(2)12/h4-7H,3H2,1-2H3 |
| InChIKey | UYDSGXAKLVZWIJ-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 2778-279°C (Expl.) |
| 272.55°C at 760 mmHg (Cal.) | |
| Flash point | 110°C (Expl.) |
| 129.504°C (Cal.) | |
| SDS | Available |
|---|---|
| Market Analysis Reports |