| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Anthracen-9-Ol |
|---|---|
| Synonyms | 9-Anthracenol; 9-Anthrol; 9-Anthranol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 |
| CAS Registry Number | 529-86-2 |
| SMILES | C1=CC=CC2=C1C(=C3C(=C2)C=CC=C3)O |
| InChI | 1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15H |
| InChIKey | AUKRYONWZHRJRE-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.5±14.0°C at 760 mmHg (Cal.) |
| Flash point | 197.7±12.0°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |