|
CAS#: 531-02-2 Product: [1,1'-Biphenyl]-3,3',5,5'-Tetraol No suppilers available for the product. |
| Name | [1,1'-Biphenyl]-3,3',5,5'-Tetraol |
|---|---|
| Synonyms | 5-(3,5-Dihydroxyphenyl)Resorcinol; (1,1'-Biphenyl)-3,3',5,5'-Tetraol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 531-02-2 |
| EINECS | 208-500-2 |
| SMILES | C1=C(O)C=C(C=C1O)C2=CC(=CC(=C2)O)O |
| InChI | 1S/C12H10O4/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8/h1-6,13-16H |
| InChIKey | VZLUGGCFYPMLMI-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.593°C at 760 mmHg (Cal.) |
| Flash point | 261.697°C (Cal.) |
| (1) | Pier Lucio Anelli, Marino Brocchetta, (the late) Costantino Maffezzoni, Paola Paoli, Patrizia Rossi, Fulvio Uggeri and Massimo Visigalli. Syntheses and X-ray crystal structures of derivatives of 2,2',4,4',6,6'-hexaiodobiphenyl, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1175. |
|---|---|
| Market Analysis Reports |