| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ECA International Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (847) 358-8178 | |||
![]() |
order@ecacorporation.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | |||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-N,N,N',N'-Tetramethyl-1,2-Cyclohexanediamine |
|---|---|
| Synonyms | (1R,2R)-1N,1N,2N,2N-Tetramethylcyclohexane-1,2-diamine; (1R,2R)-N,N,N,N-tetramethyl-1,2-cyclohexanediamine; (1R,2r)-n,n,n''n''-tetramethyl-1,2-cyclohexanediamine |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 |
| CAS Registry Number | 53152-69-5 |
| SMILES | N([C@@H]1CCCC[C@H]1N(C)C)(C)C |
| InChI | 1S/C10H22N2/c1-11(2)9-7-5-6-8-10(9)12(3)4/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | DVDGHRQOLYEZAE-NXEZZACHSA-N |
| Density | 0.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.778°C at 760 mmHg (Cal.) |
| Flash point | 76.561°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Pablo García-Álvarez, Alan R. Kennedy, Charles T. O'Hara, Kieran Reilly and Gemma M. Robertson. Synthesis and structural chemistry of alkali metal tris(HMDS) magnesiates containing chiral diamine donor ligands, Dalton Trans., 2011, 40, 5332. |
|---|---|
| Market Analysis Reports |