| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Nisoxetine |
|---|---|
| Synonyms | 3-(2-Methoxyphenoxy)-N-Methyl-3-Phenyl-Propan-1-Amine; [3-(2-Methoxyphenoxy)-3-Phenyl-Propyl]-Methyl-Amine; Nsc283481 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 |
| CAS Registry Number | 53179-07-0 |
| SMILES | C1=CC=CC=C1C(OC2=CC=CC=C2OC)CCNC |
| InChI | 1S/C17H21NO2/c1-18-13-12-15(14-8-4-3-5-9-14)20-17-11-7-6-10-16(17)19-2/h3-11,15,18H,12-13H2,1-2H3 |
| InChIKey | ITJNARMNRKSWTA-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.793°C at 760 mmHg (Cal.) |
| Flash point | 170.629°C (Cal.) |
| (1) | Jacob Andersen, Anders S. Kristensen, Benny Bang-Andersen and Kristian Strømgaard. Recent advances in the understanding of the interaction of antidepressant drugs with serotonin and norepinephrine transporters, Chem. Commun., 2009, 3677. |
|---|---|
| Market Analysis Reports |